About 6-[(1E)-buta-1,3-dienyl]-4-methoxypyran-2-one
6-[(1E)-buta-1,3-dienyl]-4-methoxypyran-2-one (PubChem CID 6476408) has the molecular formula C10H10O3
and a molecular weight of 178.19 g/mol. Its IUPAC name is 6-[(1E)-buta-1,3-dienyl]-4-methoxypyran-2-one.
Molecular Properties
| Compound Name | 6-[(1E)-buta-1,3-dienyl]-4-methoxypyran-2-one |
| PubChem CID | 6476408 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 6-[(1E)-buta-1,3-dienyl]-4-methoxypyran-2-one |
| SMILES | C=C/C=C/c1cc(OC)cc(=O)o1 |
| InChI | InChI=1S/C10H10O3/c1-3-4-5-8-6-9(12-2)7-10(11)13-8/h3-7H,1H2,2H3/b5-4+ |
| InChIKey | FWHHUGFUPIKHPB-SNAWJCMRSA-N |
| XLogP | 1.85 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 6-[(1E)-buta-1,3-dienyl]-4-methoxypyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(1E)-buta-1,3-dienyl]-4-methoxypyran-2-one?
The IUPAC name of 6-[(1E)-buta-1,3-dienyl]-4-methoxypyran-2-one (CID 6476408) is 6-[(1E)-buta-1,3-dienyl]-4-methoxypyran-2-one.
What is the SMILES notation for 6-[(1E)-buta-1,3-dienyl]-4-methoxypyran-2-one?
The canonical SMILES for 6-[(1E)-buta-1,3-dienyl]-4-methoxypyran-2-one is C=C/C=C/c1cc(OC)cc(=O)o1.
What is the InChIKey of 6-[(1E)-buta-1,3-dienyl]-4-methoxypyran-2-one?
The InChIKey is FWHHUGFUPIKHPB-SNAWJCMRSA-N. The full InChI is InChI=1S/C10H10O3/c1-3-4-5-8-6-9(12-2)7-10(11)13-8/h3-7H,1H2,2H3/b5-4+.
What are the key properties of 6-[(1E)-buta-1,3-dienyl]-4-methoxypyran-2-one?
6-[(1E)-buta-1,3-dienyl]-4-methoxypyran-2-one has a molecular weight of 178.19 g/mol, XLogP of 1.85, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(1E)-buta-1,3-dienyl]-4-methoxypyran-2-one is sourced from PubChem (CID 6476408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).