5-(cyclopent-3-ene-1-carbonylamino)pentanoic acid

C11H17NO3 — CID 64766388

IUPAC5-(cyclopent-3-ene-1-carbonylamino)pentanoic acid
SMILESO=C(O)CCCCNC(=O)C1CC=CC1
InChIInChI=1S/C11H17NO3/c13-10(14)7-3-4-8-12-11(15)9-5-1-2-6-9/h1-2,9H,3-8H2,(H,12,15)(H,13,14)
InChIKeyHZRKITIARSAHKF-UHFFFAOYSA-N
MW211.26 g/mol
LogP1.32
Rot. Bonds6

About 5-(cyclopent-3-ene-1-carbonylamino)pentanoic acid

5-(cyclopent-3-ene-1-carbonylamino)pentanoic acid (PubChem CID 64766388) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 5-(cyclopent-3-ene-1-carbonylamino)pentanoic acid.

Molecular Properties

Compound Name5-(cyclopent-3-ene-1-carbonylamino)pentanoic acid
PubChem CID64766388
Molecular FormulaC11H17NO3
Molecular Weight211.26 g/mol
Exact Mass211.12
IUPAC Name5-(cyclopent-3-ene-1-carbonylamino)pentanoic acid
SMILESO=C(O)CCCCNC(=O)C1CC=CC1
InChIInChI=1S/C11H17NO3/c13-10(14)7-3-4-8-12-11(15)9-5-1-2-6-9/h1-2,9H,3-8H2,(H,12,15)(H,13,14)
InChIKeyHZRKITIARSAHKF-UHFFFAOYSA-N
XLogP1.32
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.26
LogP ≤ 51.32
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 5-(cyclopent-3-ene-1-carbonylamino)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

7-(cyclopent-3-ene-1-carbonylamino)heptanoic acid
CID 64766728
3-(cyclopent-3-ene-1-carbonylamino)propanoic acid
CID 64767078
6-(cyclobutanecarbonylamino)hexanoic acid
CID 16786054
7-(cyclooctanecarbonylamino)heptanoic acid
CID 65019467
6-(3-carboxypropylcarbamoyl)cyclohex-3-ene-1-carboxylic acid
CID 54868731
3-(cyclohex-3-ene-1-carbonylamino)propanoic acid
CID 24699989
7-(oxane-4-carbonylamino)heptanoic acid
CID 28779379
7-(pyrrolidine-3-carbonylamino)heptanoic acid
CID 63005734
6-[(3-aminocyclopentanecarbonyl)amino]hexanoic acid
CID 66010231
N-(3-azidopropyl)cyclopent-3-ene-1-carboxamide
CID 64766321
7-[(3-aminocyclohexanecarbonyl)amino]heptanoic acid
CID 63047132
6-[[4-(cyclopentanecarbonylamino)cyclohexanecarbonyl]amino]hexanoic acid
CID 119220217

Frequently Asked Questions

What is the IUPAC name of 5-(cyclopent-3-ene-1-carbonylamino)pentanoic acid?
The IUPAC name of 5-(cyclopent-3-ene-1-carbonylamino)pentanoic acid (CID 64766388) is 5-(cyclopent-3-ene-1-carbonylamino)pentanoic acid.
What is the SMILES notation for 5-(cyclopent-3-ene-1-carbonylamino)pentanoic acid?
The canonical SMILES for 5-(cyclopent-3-ene-1-carbonylamino)pentanoic acid is O=C(O)CCCCNC(=O)C1CC=CC1.
What is the InChIKey of 5-(cyclopent-3-ene-1-carbonylamino)pentanoic acid?
The InChIKey is HZRKITIARSAHKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO3/c13-10(14)7-3-4-8-12-11(15)9-5-1-2-6-9/h1-2,9H,3-8H2,(H,12,15)(H,13,14).
What are the key properties of 5-(cyclopent-3-ene-1-carbonylamino)pentanoic acid?
5-(cyclopent-3-ene-1-carbonylamino)pentanoic acid has a molecular weight of 211.26 g/mol, XLogP of 1.32, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(cyclopent-3-ene-1-carbonylamino)pentanoic acid is sourced from PubChem (CID 64766388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).