C11H10FN3O3 — CID 64768035
1-[(2-amino-4-fluorophenyl)methyl]-3-methylimidazolidine-2,4,5-trione (PubChem CID 64768035) has the molecular formula C11H10FN3O3 and a molecular weight of 251.22 g/mol. Its IUPAC name is 1-[(2-amino-4-fluorophenyl)methyl]-3-methylimidazolidine-2,4,5-trione.
| Compound Name | 1-[(2-amino-4-fluorophenyl)methyl]-3-methylimidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 64768035 |
| Molecular Formula | C11H10FN3O3 |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 1-[(2-amino-4-fluorophenyl)methyl]-3-methylimidazolidine-2,4,5-trione |
| SMILES | CN1C(=O)C(=O)N(Cc2ccc(F)cc2N)C1=O |
| InChI | InChI=1S/C11H10FN3O3/c1-14-9(16)10(17)15(11(14)18)5-6-2-3-7(12)4-8(6)13/h2-4H,5,13H2,1H3 |
| InChIKey | QWHSLLHEVNFOFV-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|