C11H11FN2OS — CID 64769209
3-[(2-amino-4-fluorophenyl)methyl]-4-methyl-1,3-thiazol-2-one (PubChem CID 64769209) has the molecular formula C11H11FN2OS and a molecular weight of 238.29 g/mol. Its IUPAC name is 3-[(2-amino-4-fluorophenyl)methyl]-4-methyl-1,3-thiazol-2-one.
| Compound Name | 3-[(2-amino-4-fluorophenyl)methyl]-4-methyl-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 64769209 |
| Molecular Formula | C11H11FN2OS |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 3-[(2-amino-4-fluorophenyl)methyl]-4-methyl-1,3-thiazol-2-one |
| SMILES | Cc1csc(=O)n1Cc1ccc(F)cc1N |
| InChI | InChI=1S/C11H11FN2OS/c1-7-6-16-11(15)14(7)5-8-2-3-9(12)4-10(8)13/h2-4,6H,5,13H2,1H3 |
| InChIKey | JADFIKMEKUWQEX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|