C26H23FN4O5 — CID 6477187
1-cyclopropyl-7-[4-[(2,3-dioxoindol-1-yl)methyl]piperazin-1-yl]-6-fluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 6477187) has the molecular formula C26H23FN4O5 and a molecular weight of 490.49 g/mol. Its IUPAC name is 1-cyclopropyl-7-[4-[(2,3-dioxoindol-1-yl)methyl]piperazin-1-yl]-6-fluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-7-[4-[(2,3-dioxoindol-1-yl)methyl]piperazin-1-yl]-6-fluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 6477187 |
| Molecular Formula | C26H23FN4O5 |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 1-cyclopropyl-7-[4-[(2,3-dioxoindol-1-yl)methyl]piperazin-1-yl]-6-fluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | O=C1C(=O)N(CN2CCN(c3cc4c(cc3F)c(=O)c(C(=O)O)cn4C3CC3)CC2)c2ccccc21 |
| InChI | InChI=1S/C26H23FN4O5/c27-19-11-17-21(30(15-5-6-15)13-18(23(17)32)26(35)36)12-22(19)29-9-7-28(8-10-29)14-31-20-4-2-1-3-16(20)24(33)25(31)34/h1-4,11-13,15H,5-10,14H2,(H,35,36) |
| InChIKey | UBUODDFHCHLKJK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|