C15H25N3O2 — CID 64772396
3-[1-[(1-propan-2-ylpyrazol-3-yl)methyl]piperidin-4-yl]propanoic acid (PubChem CID 64772396) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is 3-[1-[(1-propan-2-ylpyrazol-3-yl)methyl]piperidin-4-yl]propanoic acid.
| Compound Name | 3-[1-[(1-propan-2-ylpyrazol-3-yl)methyl]piperidin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 64772396 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | 3-[1-[(1-propan-2-ylpyrazol-3-yl)methyl]piperidin-4-yl]propanoic acid |
| SMILES | CC(C)n1ccc(CN2CCC(CCC(=O)O)CC2)n1 |
| InChI | InChI=1S/C15H25N3O2/c1-12(2)18-10-7-14(16-18)11-17-8-5-13(6-9-17)3-4-15(19)20/h7,10,12-13H,3-6,8-9,11H2,1-2H3,(H,19,20) |
| InChIKey | CNVXSNOPJCVVTO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |