C13H24N4 — CID 64771254
[1-[(1-propan-2-ylpyrazol-3-yl)methyl]piperidin-4-yl]methanamine (PubChem CID 64771254) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is [1-[(1-propan-2-ylpyrazol-3-yl)methyl]piperidin-4-yl]methanamine.
| Compound Name | [1-[(1-propan-2-ylpyrazol-3-yl)methyl]piperidin-4-yl]methanamine |
|---|---|
| PubChem CID | 64771254 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | [1-[(1-propan-2-ylpyrazol-3-yl)methyl]piperidin-4-yl]methanamine |
| SMILES | CC(C)n1ccc(CN2CCC(CN)CC2)n1 |
| InChI | InChI=1S/C13H24N4/c1-11(2)17-8-5-13(15-17)10-16-6-3-12(9-14)4-7-16/h5,8,11-12H,3-4,6-7,9-10,14H2,1-2H3 |
| InChIKey | AETNHJIUUMWBFH-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |