C16H29N5 — CID 80553361
1-[1-[(1-propan-2-ylpyrazol-3-yl)methyl]pyrrolidin-3-yl]piperidin-4-amine (PubChem CID 80553361) has the molecular formula C16H29N5 and a molecular weight of 291.44 g/mol. Its IUPAC name is 1-[1-[(1-propan-2-ylpyrazol-3-yl)methyl]pyrrolidin-3-yl]piperidin-4-amine.
| Compound Name | 1-[1-[(1-propan-2-ylpyrazol-3-yl)methyl]pyrrolidin-3-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 80553361 |
| Molecular Formula | C16H29N5 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.24 |
| IUPAC Name | 1-[1-[(1-propan-2-ylpyrazol-3-yl)methyl]pyrrolidin-3-yl]piperidin-4-amine |
| SMILES | CC(C)n1ccc(CN2CCC(N3CCC(N)CC3)C2)n1 |
| InChI | InChI=1S/C16H29N5/c1-13(2)21-10-5-15(18-21)11-19-7-6-16(12-19)20-8-3-14(17)4-9-20/h5,10,13-14,16H,3-4,6-9,11-12,17H2,1-2H3 |
| InChIKey | KNBJFEZELHNIOM-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 50.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |