C14H22N2OS — CID 64776773
2-amino-4,6-dimethyl-N-propan-2-yl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 64776773) has the molecular formula C14H22N2OS and a molecular weight of 266.41 g/mol. Its IUPAC name is 2-amino-4,6-dimethyl-N-propan-2-yl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-amino-4,6-dimethyl-N-propan-2-yl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 64776773 |
| Molecular Formula | C14H22N2OS |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 2-amino-4,6-dimethyl-N-propan-2-yl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC1Cc2sc(N)c(C(=O)NC(C)C)c2C(C)C1 |
| InChI | InChI=1S/C14H22N2OS/c1-7(2)16-14(17)12-11-9(4)5-8(3)6-10(11)18-13(12)15/h7-9H,5-6,15H2,1-4H3,(H,16,17) |
| InChIKey | FGVJCEHOCLIHIT-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|