C10H14N2OS — CID 735029
(4R)-2-amino-4-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 735029) has the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. Its IUPAC name is (4R)-2-amino-4-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (4R)-2-amino-4-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 735029 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | (4R)-2-amino-4-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | C[C@@H]1CCCc2sc(N)c(C(N)=O)c21 |
| InChI | InChI=1S/C10H14N2OS/c1-5-3-2-4-6-7(5)8(9(11)13)10(12)14-6/h5H,2-4,12H2,1H3,(H2,11,13)/t5-/m1/s1 |
| InChIKey | YUJDMCQEVFLVLZ-RXMQYKEDSA-N |
| XLogP | 1.87 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|