C16H24N2OS — CID 64775355
(2-amino-4,5-dimethyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-piperidin-1-ylmethanone (PubChem CID 64775355) has the molecular formula C16H24N2OS and a molecular weight of 292.45 g/mol. Its IUPAC name is (2-amino-4,5-dimethyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-piperidin-1-ylmethanone.
| Compound Name | (2-amino-4,5-dimethyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 64775355 |
| Molecular Formula | C16H24N2OS |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | (2-amino-4,5-dimethyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-piperidin-1-ylmethanone |
| SMILES | CC1CCc2sc(N)c(C(=O)N3CCCCC3)c2C1C |
| InChI | InChI=1S/C16H24N2OS/c1-10-6-7-12-13(11(10)2)14(15(17)20-12)16(19)18-8-4-3-5-9-18/h10-11H,3-9,17H2,1-2H3 |
| InChIKey | UTMXTMGZLCPMTJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|