C17H24N2OS — CID 114817988
(2-aminospiro[5,7-dihydro-4H-1-benzothiophene-6,1'-cyclopentane]-3-yl)-pyrrolidin-1-ylmethanone (PubChem CID 114817988) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is (2-aminospiro[5,7-dihydro-4H-1-benzothiophene-6,1'-cyclopentane]-3-yl)-pyrrolidin-1-ylmethanone.
| Compound Name | (2-aminospiro[5,7-dihydro-4H-1-benzothiophene-6,1'-cyclopentane]-3-yl)-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 114817988 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | (2-aminospiro[5,7-dihydro-4H-1-benzothiophene-6,1'-cyclopentane]-3-yl)-pyrrolidin-1-ylmethanone |
| SMILES | Nc1sc2c(c1C(=O)N1CCCC1)CCC1(CCCC1)C2 |
| InChI | InChI=1S/C17H24N2OS/c18-15-14(16(20)19-9-3-4-10-19)12-5-8-17(6-1-2-7-17)11-13(12)21-15/h1-11,18H2 |
| InChIKey | QGMZVZCDZSNGAX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|