C22H27NO2S — CID 59982160
6-(azepane-1-carbonyl)-3,3-dimethyl-2,4-dihydro-1H-thioxanthen-9-one (PubChem CID 59982160) has the molecular formula C22H27NO2S and a molecular weight of 369.53 g/mol. Its IUPAC name is 6-(azepane-1-carbonyl)-3,3-dimethyl-2,4-dihydro-1H-thioxanthen-9-one.
| Compound Name | 6-(azepane-1-carbonyl)-3,3-dimethyl-2,4-dihydro-1H-thioxanthen-9-one |
|---|---|
| PubChem CID | 59982160 |
| Molecular Formula | C22H27NO2S |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 6-(azepane-1-carbonyl)-3,3-dimethyl-2,4-dihydro-1H-thioxanthen-9-one |
| SMILES | CC1(C)CCc2c(sc3cc(C(=O)N4CCCCCC4)ccc3c2=O)C1 |
| InChI | InChI=1S/C22H27NO2S/c1-22(2)10-9-17-19(14-22)26-18-13-15(7-8-16(18)20(17)24)21(25)23-11-5-3-4-6-12-23/h7-8,13H,3-6,9-12,14H2,1-2H3 |
| InChIKey | ZDPYHKRFXHXRTF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |