C16H20N2O2 — CID 100815471
4,4-dimethyl-6-(pyrrolidine-1-carbonyl)-1,3-dihydroquinolin-2-one (PubChem CID 100815471) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 4,4-dimethyl-6-(pyrrolidine-1-carbonyl)-1,3-dihydroquinolin-2-one.
| Compound Name | 4,4-dimethyl-6-(pyrrolidine-1-carbonyl)-1,3-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 100815471 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 4,4-dimethyl-6-(pyrrolidine-1-carbonyl)-1,3-dihydroquinolin-2-one |
| SMILES | CC1(C)CC(=O)Nc2ccc(C(=O)N3CCCC3)cc21 |
| InChI | InChI=1S/C16H20N2O2/c1-16(2)10-14(19)17-13-6-5-11(9-12(13)16)15(20)18-7-3-4-8-18/h5-6,9H,3-4,7-8,10H2,1-2H3,(H,17,19) |
| InChIKey | NHAIEWRVARPXEA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |