C12H14N2O4S — CID 90911127
7-amino-1,3,3a,4,5,8b-hexahydrothieno[3,2-e]isoindole-2,8-dicarboxylic acid (PubChem CID 90911127) has the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. Its IUPAC name is 7-amino-1,3,3a,4,5,8b-hexahydrothieno[3,2-e]isoindole-2,8-dicarboxylic acid.
| Compound Name | 7-amino-1,3,3a,4,5,8b-hexahydrothieno[3,2-e]isoindole-2,8-dicarboxylic acid |
|---|---|
| PubChem CID | 90911127 |
| Molecular Formula | C12H14N2O4S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 7-amino-1,3,3a,4,5,8b-hexahydrothieno[3,2-e]isoindole-2,8-dicarboxylic acid |
| SMILES | Nc1sc2c(c1C(=O)O)C1CN(C(=O)O)CC1CC2 |
| InChI | InChI=1S/C12H14N2O4S/c13-10-9(11(15)16)8-6-4-14(12(17)18)3-5(6)1-2-7(8)19-10/h5-6H,1-4,13H2,(H,15,16)(H,17,18) |
| InChIKey | RWCFYSDQQRWDTB-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|