C17H28N2O — CID 64777572
6-(1-cyclohexylpyrazol-3-yl)-2,2-dimethylhexan-3-one (PubChem CID 64777572) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is 6-(1-cyclohexylpyrazol-3-yl)-2,2-dimethylhexan-3-one.
| Compound Name | 6-(1-cyclohexylpyrazol-3-yl)-2,2-dimethylhexan-3-one |
|---|---|
| PubChem CID | 64777572 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 6-(1-cyclohexylpyrazol-3-yl)-2,2-dimethylhexan-3-one |
| SMILES | CC(C)(C)C(=O)CCCc1ccn(C2CCCCC2)n1 |
| InChI | InChI=1S/C17H28N2O/c1-17(2,3)16(20)11-7-8-14-12-13-19(18-14)15-9-5-4-6-10-15/h12-13,15H,4-11H2,1-3H3 |
| InChIKey | SDUWENAGKBJPGI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |