C14H23BrN2 — CID 66050139
3-(3-bromo-2,2-dimethylpropyl)-1-cyclohexylpyrazole (PubChem CID 66050139) has the molecular formula C14H23BrN2 and a molecular weight of 299.26 g/mol. Its IUPAC name is 3-(3-bromo-2,2-dimethylpropyl)-1-cyclohexylpyrazole.
| Compound Name | 3-(3-bromo-2,2-dimethylpropyl)-1-cyclohexylpyrazole |
|---|---|
| PubChem CID | 66050139 |
| Molecular Formula | C14H23BrN2 |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 3-(3-bromo-2,2-dimethylpropyl)-1-cyclohexylpyrazole |
| SMILES | CC(C)(CBr)Cc1ccn(C2CCCCC2)n1 |
| InChI | InChI=1S/C14H23BrN2/c1-14(2,11-15)10-12-8-9-17(16-12)13-6-4-3-5-7-13/h8-9,13H,3-7,10-11H2,1-2H3 |
| InChIKey | NATAIAZNZGMUDU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|