C15H25BrN2 — CID 64777282
3-(3-bromo-4,4-dimethylpentyl)-1-cyclopentylpyrazole (PubChem CID 64777282) has the molecular formula C15H25BrN2 and a molecular weight of 313.28 g/mol. Its IUPAC name is 3-(3-bromo-4,4-dimethylpentyl)-1-cyclopentylpyrazole.
| Compound Name | 3-(3-bromo-4,4-dimethylpentyl)-1-cyclopentylpyrazole |
|---|---|
| PubChem CID | 64777282 |
| Molecular Formula | C15H25BrN2 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 3-(3-bromo-4,4-dimethylpentyl)-1-cyclopentylpyrazole |
| SMILES | CC(C)(C)C(Br)CCc1ccn(C2CCCC2)n1 |
| InChI | InChI=1S/C15H25BrN2/c1-15(2,3)14(16)9-8-12-10-11-18(17-12)13-6-4-5-7-13/h10-11,13-14H,4-9H2,1-3H3 |
| InChIKey | DHJSKYDCRAMBKI-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|