C15H25ClN2 — CID 64779835
3-(3-chloro-4,4-dimethylpentyl)-1-cyclopentylpyrazole (PubChem CID 64779835) has the molecular formula C15H25ClN2 and a molecular weight of 268.83 g/mol. Its IUPAC name is 3-(3-chloro-4,4-dimethylpentyl)-1-cyclopentylpyrazole.
| Compound Name | 3-(3-chloro-4,4-dimethylpentyl)-1-cyclopentylpyrazole |
|---|---|
| PubChem CID | 64779835 |
| Molecular Formula | C15H25ClN2 |
| Molecular Weight | 268.83 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 3-(3-chloro-4,4-dimethylpentyl)-1-cyclopentylpyrazole |
| SMILES | CC(C)(C)C(Cl)CCc1ccn(C2CCCC2)n1 |
| InChI | InChI=1S/C15H25ClN2/c1-15(2,3)14(16)9-8-12-10-11-18(17-12)13-6-4-5-7-13/h10-11,13-14H,4-9H2,1-3H3 |
| InChIKey | CJXDBXVUVXZJDM-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.83 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|