C16H27ClN2 — CID 114211844
3-(2-chloro-5,5-dimethylhexyl)-1-cyclopentylpyrazole (PubChem CID 114211844) has the molecular formula C16H27ClN2 and a molecular weight of 282.86 g/mol. Its IUPAC name is 3-(2-chloro-5,5-dimethylhexyl)-1-cyclopentylpyrazole.
| Compound Name | 3-(2-chloro-5,5-dimethylhexyl)-1-cyclopentylpyrazole |
|---|---|
| PubChem CID | 114211844 |
| Molecular Formula | C16H27ClN2 |
| Molecular Weight | 282.86 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 3-(2-chloro-5,5-dimethylhexyl)-1-cyclopentylpyrazole |
| SMILES | CC(C)(C)CCC(Cl)Cc1ccn(C2CCCC2)n1 |
| InChI | InChI=1S/C16H27ClN2/c1-16(2,3)10-8-13(17)12-14-9-11-19(18-14)15-6-4-5-7-15/h9,11,13,15H,4-8,10,12H2,1-3H3 |
| InChIKey | YEMNOGSXJNTWOG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.86 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|