C8H13N5O2 — CID 64777594
1-(4-hydrazinyl-4-oxobutyl)pyrazole-3-carboxamide (PubChem CID 64777594) has the molecular formula C8H13N5O2 and a molecular weight of 211.22 g/mol. Its IUPAC name is 1-(4-hydrazinyl-4-oxobutyl)pyrazole-3-carboxamide.
| Compound Name | 1-(4-hydrazinyl-4-oxobutyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 64777594 |
| Molecular Formula | C8H13N5O2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 1-(4-hydrazinyl-4-oxobutyl)pyrazole-3-carboxamide |
| SMILES | NNC(=O)CCCn1ccc(C(N)=O)n1 |
| InChI | InChI=1S/C8H13N5O2/c9-8(15)6-3-5-13(12-6)4-1-2-7(14)11-10/h3,5H,1-2,4,10H2,(H2,9,15)(H,11,14) |
| InChIKey | IAKAAJXHWKJWAH-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 116.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|