C22H25BrN3O9P — CID 6478067
[(2R,3S,5R)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-2-[(8-methyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-3-yl] (2R)-2-aminopropanoate (PubChem CID 6478067) has the molecular formula C22H25BrN3O9P and a molecular weight of 586.33 g/mol. Its IUPAC name is [(2R,3S,5R)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-2-[(8-methyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-3-yl] (2R)-2-aminopropanoate.
| Compound Name | [(2R,3S,5R)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-2-[(8-methyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-3-yl] (2R)-2-aminopropanoate |
|---|---|
| PubChem CID | 6478067 |
| Molecular Formula | C22H25BrN3O9P |
| Molecular Weight | 586.33 g/mol |
| Exact Mass | 585.05 |
| IUPAC Name | [(2R,3S,5R)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-2-[(8-methyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-3-yl] (2R)-2-aminopropanoate |
| SMILES | Cc1cccc2c1OP(=O)(OC[C@H]1O[C@@H](n3cc(/C=C/Br)c(=O)[nH]c3=O)C[C@@H]1OC(=O)[C@@H](C)N)OC2 |
| InChI | InChI=1S/C22H25BrN3O9P/c1-12-4-3-5-15-10-31-36(30,35-19(12)15)32-11-17-16(34-21(28)13(2)24)8-18(33-17)26-9-14(6-7-23)20(27)25-22(26)29/h3-7,9,13,16-18H,8,10-11,24H2,1-2H3,(H,25,27,29)/b7-6+/t13-,16+,17-,18-,36?/m1/s1 |
| InChIKey | DYWPWSYDOUGNBT-XRILFLMGSA-N |
| XLogP | 2.49 |
| TPSA | 161.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|