C25H31BrN3O9P — CID 6478073
[(2R,3S,5R)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-2-[(8-methyl-2-oxo-4H-1,3,2lambda5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-3-yl] 2-amino-3-methylpentanoate (PubChem CID 6478073) has the molecular formula C25H31BrN3O9P and a molecular weight of 628.41 g/mol. Its IUPAC name is [(2R,3S,5R)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-2-[(8-methyl-2-oxo-4H-1,3,2lambda5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-3-yl] 2-amino-3-methylpentanoate.
| Compound Name | [(2R,3S,5R)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-2-[(8-methyl-2-oxo-4H-1,3,2lambda5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-3-yl] 2-amino-3-methylpentanoate |
|---|---|
| PubChem CID | 6478073 |
| Molecular Formula | C25H31BrN3O9P |
| Molecular Weight | 628.41 g/mol |
| Exact Mass | 627.10 |
| IUPAC Name | [(2R,3S,5R)-5-[5-[(E)-2-bromoethenyl]-2,4-dioxopyrimidin-1-yl]-2-[(8-methyl-2-oxo-4H-1,3,2lambda5-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-3-yl] 2-amino-3-methylpentanoate |
| SMILES | CCC(C)C(N)C(=O)O[C@H]1C[C@H](n2cc(/C=C/Br)c(=O)[nH]c2=O)O[C@@H]1COP1(=O)OCc2cccc(C)c2O1 |
| InChI | InChI=1S/C25H31BrN3O9P/c1-4-14(2)21(27)24(31)37-18-10-20(29-11-16(8-9-26)23(30)28-25(29)32)36-19(18)13-35-39(33)34-12-17-7-5-6-15(3)22(17)38-39/h5-9,11,14,18-21H,4,10,12-13,27H2,1-3H3,(H,28,30,32)/b9-8+/t14?,18-,19+,20+,21?,39?/m0/s1 |
| InChIKey | OIGKRGVZRKAOIK-CHDDKKEYSA-N |
| XLogP | 3.52 |
| TPSA | 161.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|