C17H15N3O3S — CID 6478348
(E)-N-[(1S)-1-(5-methyl-4-oxothieno[2,3-d][1,3]oxazin-2-yl)ethyl]-3-pyridin-2-ylprop-2-enamide (PubChem CID 6478348) has the molecular formula C17H15N3O3S and a molecular weight of 341.39 g/mol. Its IUPAC name is (E)-N-[(1S)-1-(5-methyl-4-oxothieno[2,3-d][1,3]oxazin-2-yl)ethyl]-3-pyridin-2-ylprop-2-enamide.
| Compound Name | (E)-N-[(1S)-1-(5-methyl-4-oxothieno[2,3-d][1,3]oxazin-2-yl)ethyl]-3-pyridin-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 6478348 |
| Molecular Formula | C17H15N3O3S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | (E)-N-[(1S)-1-(5-methyl-4-oxothieno[2,3-d][1,3]oxazin-2-yl)ethyl]-3-pyridin-2-ylprop-2-enamide |
| SMILES | Cc1csc2nc([C@H](C)NC(=O)/C=C/c3ccccn3)oc(=O)c12 |
| InChI | InChI=1S/C17H15N3O3S/c1-10-9-24-16-14(10)17(22)23-15(20-16)11(2)19-13(21)7-6-12-5-3-4-8-18-12/h3-9,11H,1-2H3,(H,19,21)/b7-6+/t11-/m0/s1 |
| InChIKey | IZEOZHHCGSUVNF-MLRMMBSGSA-N |
| XLogP | 2.84 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|