C16H29N5 — CID 64784047
N-[(1-cyclopentylpyrazol-3-yl)methyl]-N-methyl-2-piperazin-1-ylethanamine (PubChem CID 64784047) has the molecular formula C16H29N5 and a molecular weight of 291.44 g/mol. Its IUPAC name is N-[(1-cyclopentylpyrazol-3-yl)methyl]-N-methyl-2-piperazin-1-ylethanamine.
| Compound Name | N-[(1-cyclopentylpyrazol-3-yl)methyl]-N-methyl-2-piperazin-1-ylethanamine |
|---|---|
| PubChem CID | 64784047 |
| Molecular Formula | C16H29N5 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.24 |
| IUPAC Name | N-[(1-cyclopentylpyrazol-3-yl)methyl]-N-methyl-2-piperazin-1-ylethanamine |
| SMILES | CN(CCN1CCNCC1)Cc1ccn(C2CCCC2)n1 |
| InChI | InChI=1S/C16H29N5/c1-19(12-13-20-10-7-17-8-11-20)14-15-6-9-21(18-15)16-4-2-3-5-16/h6,9,16-17H,2-5,7-8,10-14H2,1H3 |
| InChIKey | ZZAQTFKZCWJZJT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |