C16H28BrN3 — CID 107204922
5-bromo-N-[(1-cyclohexylpyrazol-3-yl)methyl]-N-methylpentan-1-amine (PubChem CID 107204922) has the molecular formula C16H28BrN3 and a molecular weight of 342.33 g/mol. Its IUPAC name is 5-bromo-N-[(1-cyclohexylpyrazol-3-yl)methyl]-N-methylpentan-1-amine.
| Compound Name | 5-bromo-N-[(1-cyclohexylpyrazol-3-yl)methyl]-N-methylpentan-1-amine |
|---|---|
| PubChem CID | 107204922 |
| Molecular Formula | C16H28BrN3 |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 5-bromo-N-[(1-cyclohexylpyrazol-3-yl)methyl]-N-methylpentan-1-amine |
| SMILES | CN(CCCCCBr)Cc1ccn(C2CCCCC2)n1 |
| InChI | InChI=1S/C16H28BrN3/c1-19(12-7-3-6-11-17)14-15-10-13-20(18-15)16-8-4-2-5-9-16/h10,13,16H,2-9,11-12,14H2,1H3 |
| InChIKey | KLUKEGUESZNQPM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|