C11H16ClNO3S — CID 64786790
N-(2-chloro-4-hydroxyphenyl)-2,2-dimethylpropane-1-sulfonamide (PubChem CID 64786790) has the molecular formula C11H16ClNO3S and a molecular weight of 277.77 g/mol. Its IUPAC name is N-(2-chloro-4-hydroxyphenyl)-2,2-dimethylpropane-1-sulfonamide.
| Compound Name | N-(2-chloro-4-hydroxyphenyl)-2,2-dimethylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 64786790 |
| Molecular Formula | C11H16ClNO3S |
| Molecular Weight | 277.77 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | N-(2-chloro-4-hydroxyphenyl)-2,2-dimethylpropane-1-sulfonamide |
| SMILES | CC(C)(C)CS(=O)(=O)Nc1ccc(O)cc1Cl |
| InChI | InChI=1S/C11H16ClNO3S/c1-11(2,3)7-17(15,16)13-10-5-4-8(14)6-9(10)12/h4-6,13-14H,7H2,1-3H3 |
| InChIKey | KUSDQSGVOZOZRP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.77 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|