C11H12ClN3O3S — CID 64788920
N-(2-chloro-4-hydroxyphenyl)-1,2-dimethylimidazole-4-sulfonamide (PubChem CID 64788920) has the molecular formula C11H12ClN3O3S and a molecular weight of 301.75 g/mol. Its IUPAC name is N-(2-chloro-4-hydroxyphenyl)-1,2-dimethylimidazole-4-sulfonamide.
| Compound Name | N-(2-chloro-4-hydroxyphenyl)-1,2-dimethylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 64788920 |
| Molecular Formula | C11H12ClN3O3S |
| Molecular Weight | 301.75 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | N-(2-chloro-4-hydroxyphenyl)-1,2-dimethylimidazole-4-sulfonamide |
| SMILES | Cc1nc(S(=O)(=O)Nc2ccc(O)cc2Cl)cn1C |
| InChI | InChI=1S/C11H12ClN3O3S/c1-7-13-11(6-15(7)2)19(17,18)14-10-4-3-8(16)5-9(10)12/h3-6,14,16H,1-2H3 |
| InChIKey | PFMSKAPXAJYGDH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.75 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|