C11H12N4O5S — CID 103717307
N-(2-hydroxy-5-nitrophenyl)-1,2-dimethylimidazole-4-sulfonamide (PubChem CID 103717307) has the molecular formula C11H12N4O5S and a molecular weight of 312.31 g/mol. Its IUPAC name is N-(2-hydroxy-5-nitrophenyl)-1,2-dimethylimidazole-4-sulfonamide.
| Compound Name | N-(2-hydroxy-5-nitrophenyl)-1,2-dimethylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 103717307 |
| Molecular Formula | C11H12N4O5S |
| Molecular Weight | 312.31 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | N-(2-hydroxy-5-nitrophenyl)-1,2-dimethylimidazole-4-sulfonamide |
| SMILES | Cc1nc(S(=O)(=O)Nc2cc([N+](=O)[O-])ccc2O)cn1C |
| InChI | InChI=1S/C11H12N4O5S/c1-7-12-11(6-14(7)2)21(19,20)13-9-5-8(15(17)18)3-4-10(9)16/h3-6,13,16H,1-2H3 |
| InChIKey | SHRKCGCTGSHELB-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.31 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|