C7H6F2N2O5S — CID 107745986
1,1-difluoro-N-(2-hydroxy-5-nitrophenyl)methanesulfonamide (PubChem CID 107745986) has the molecular formula C7H6F2N2O5S and a molecular weight of 268.20 g/mol. Its IUPAC name is 1,1-difluoro-N-(2-hydroxy-5-nitrophenyl)methanesulfonamide.
| Compound Name | 1,1-difluoro-N-(2-hydroxy-5-nitrophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 107745986 |
| Molecular Formula | C7H6F2N2O5S |
| Molecular Weight | 268.20 g/mol |
| Exact Mass | 268.00 |
| IUPAC Name | 1,1-difluoro-N-(2-hydroxy-5-nitrophenyl)methanesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(O)c(NS(=O)(=O)C(F)F)c1 |
| InChI | InChI=1S/C7H6F2N2O5S/c8-7(9)17(15,16)10-5-3-4(11(13)14)1-2-6(5)12/h1-3,7,10,12H |
| InChIKey | ZYKXTENXHAWCAA-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.20 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|