C16H10N2O5 — CID 177429502
2-(2-hydroxy-5-nitroanilino)naphthalene-1,4-dione (PubChem CID 177429502) has the molecular formula C16H10N2O5 and a molecular weight of 310.27 g/mol. Its IUPAC name is 2-(2-hydroxy-5-nitroanilino)naphthalene-1,4-dione.
| Compound Name | 2-(2-hydroxy-5-nitroanilino)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 177429502 |
| Molecular Formula | C16H10N2O5 |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 2-(2-hydroxy-5-nitroanilino)naphthalene-1,4-dione |
| SMILES | O=C1C=C(Nc2cc([N+](=O)[O-])ccc2O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C16H10N2O5/c19-14-6-5-9(18(22)23)7-12(14)17-13-8-15(20)10-3-1-2-4-11(10)16(13)21/h1-8,17,19H |
| InChIKey | ZHIRXFWAKLGXTH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|