C14H31N3O — CID 64791623
2-cyclopropyl-3-[2-(dimethylamino)ethyl-methylamino]-2-(propan-2-ylamino)propan-1-ol (PubChem CID 64791623) has the molecular formula C14H31N3O and a molecular weight of 257.42 g/mol. Its IUPAC name is 2-cyclopropyl-3-[2-(dimethylamino)ethyl-methylamino]-2-(propan-2-ylamino)propan-1-ol.
| Compound Name | 2-cyclopropyl-3-[2-(dimethylamino)ethyl-methylamino]-2-(propan-2-ylamino)propan-1-ol |
|---|---|
| PubChem CID | 64791623 |
| Molecular Formula | C14H31N3O |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.25 |
| IUPAC Name | 2-cyclopropyl-3-[2-(dimethylamino)ethyl-methylamino]-2-(propan-2-ylamino)propan-1-ol |
| SMILES | CC(C)NC(CO)(CN(C)CCN(C)C)C1CC1 |
| InChI | InChI=1S/C14H31N3O/c1-12(2)15-14(11-18,13-6-7-13)10-17(5)9-8-16(3)4/h12-13,15,18H,6-11H2,1-5H3 |
| InChIKey | ZRYIKQMHTMUFDS-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |