C15H32N2O2 — CID 81063258
2-cyclopropyl-3-[methyl(2-propan-2-yloxyethyl)amino]-2-(propan-2-ylamino)propan-1-ol (PubChem CID 81063258) has the molecular formula C15H32N2O2 and a molecular weight of 272.43 g/mol. Its IUPAC name is 2-cyclopropyl-3-[methyl(2-propan-2-yloxyethyl)amino]-2-(propan-2-ylamino)propan-1-ol.
| Compound Name | 2-cyclopropyl-3-[methyl(2-propan-2-yloxyethyl)amino]-2-(propan-2-ylamino)propan-1-ol |
|---|---|
| PubChem CID | 81063258 |
| Molecular Formula | C15H32N2O2 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | 2-cyclopropyl-3-[methyl(2-propan-2-yloxyethyl)amino]-2-(propan-2-ylamino)propan-1-ol |
| SMILES | CC(C)NC(CO)(CN(C)CCOC(C)C)C1CC1 |
| InChI | InChI=1S/C15H32N2O2/c1-12(2)16-15(11-18,14-6-7-14)10-17(5)8-9-19-13(3)4/h12-14,16,18H,6-11H2,1-5H3 |
| InChIKey | SQYCTLIXJCYFIK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |