C22H23N3O3S — CID 647971
2-(3-ethylquinolin-2-yl)sulfanyl-1-[4-(furan-2-carbonyl)piperazin-1-yl]ethanone (PubChem CID 647971) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is 2-(3-ethylquinolin-2-yl)sulfanyl-1-[4-(furan-2-carbonyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(3-ethylquinolin-2-yl)sulfanyl-1-[4-(furan-2-carbonyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 647971 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 2-(3-ethylquinolin-2-yl)sulfanyl-1-[4-(furan-2-carbonyl)piperazin-1-yl]ethanone |
| SMILES | CCc1cc2ccccc2nc1SCC(=O)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C22H23N3O3S/c1-2-16-14-17-6-3-4-7-18(17)23-21(16)29-15-20(26)24-9-11-25(12-10-24)22(27)19-8-5-13-28-19/h3-8,13-14H,2,9-12,15H2,1H3 |
| InChIKey | NJYSCYPHBCFURR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |