C13H30N2O — CID 64797735
2-methyl-2-(methylamino)-4-[methyl(pentan-2-yl)amino]pentan-1-ol (PubChem CID 64797735) has the molecular formula C13H30N2O and a molecular weight of 230.40 g/mol. Its IUPAC name is 2-methyl-2-(methylamino)-4-[methyl(pentan-2-yl)amino]pentan-1-ol.
| Compound Name | 2-methyl-2-(methylamino)-4-[methyl(pentan-2-yl)amino]pentan-1-ol |
|---|---|
| PubChem CID | 64797735 |
| Molecular Formula | C13H30N2O |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.24 |
| IUPAC Name | 2-methyl-2-(methylamino)-4-[methyl(pentan-2-yl)amino]pentan-1-ol |
| SMILES | CCCC(C)N(C)C(C)CC(C)(CO)NC |
| InChI | InChI=1S/C13H30N2O/c1-7-8-11(2)15(6)12(3)9-13(4,10-16)14-5/h11-12,14,16H,7-10H2,1-6H3 |
| InChIKey | IIRKPGRBABGRNC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |