C16H22N4 — CID 64800466
N-[(1-cyclopentylpyrazol-3-yl)methyl]-2-pyridin-3-ylethanamine (PubChem CID 64800466) has the molecular formula C16H22N4 and a molecular weight of 270.38 g/mol. Its IUPAC name is N-[(1-cyclopentylpyrazol-3-yl)methyl]-2-pyridin-3-ylethanamine.
| Compound Name | N-[(1-cyclopentylpyrazol-3-yl)methyl]-2-pyridin-3-ylethanamine |
|---|---|
| PubChem CID | 64800466 |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | N-[(1-cyclopentylpyrazol-3-yl)methyl]-2-pyridin-3-ylethanamine |
| SMILES | c1cncc(CCNCc2ccn(C3CCCC3)n2)c1 |
| InChI | InChI=1S/C16H22N4/c1-2-6-16(5-1)20-11-8-15(19-20)13-18-10-7-14-4-3-9-17-12-14/h3-4,8-9,11-12,16,18H,1-2,5-7,10,13H2 |
| InChIKey | VVZXPGAHNNWXDU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|