C17H29NO2 — CID 64803053
6-(2,6-dimethylphenoxy)-2-(ethylamino)-2-methylhexan-1-ol (PubChem CID 64803053) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is 6-(2,6-dimethylphenoxy)-2-(ethylamino)-2-methylhexan-1-ol.
| Compound Name | 6-(2,6-dimethylphenoxy)-2-(ethylamino)-2-methylhexan-1-ol |
|---|---|
| PubChem CID | 64803053 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 6-(2,6-dimethylphenoxy)-2-(ethylamino)-2-methylhexan-1-ol |
| SMILES | CCNC(C)(CO)CCCCOc1c(C)cccc1C |
| InChI | InChI=1S/C17H29NO2/c1-5-18-17(4,13-19)11-6-7-12-20-16-14(2)9-8-10-15(16)3/h8-10,18-19H,5-7,11-13H2,1-4H3 |
| InChIKey | XUENTZVJOAZTLZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|