C11H23NO3S2 — CID 64806077
2-(cyclopropylamino)-2-methyl-4-(2-methylsulfonylethylsulfanyl)butan-1-ol (PubChem CID 64806077) has the molecular formula C11H23NO3S2 and a molecular weight of 281.44 g/mol. Its IUPAC name is 2-(cyclopropylamino)-2-methyl-4-(2-methylsulfonylethylsulfanyl)butan-1-ol.
| Compound Name | 2-(cyclopropylamino)-2-methyl-4-(2-methylsulfonylethylsulfanyl)butan-1-ol |
|---|---|
| PubChem CID | 64806077 |
| Molecular Formula | C11H23NO3S2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 2-(cyclopropylamino)-2-methyl-4-(2-methylsulfonylethylsulfanyl)butan-1-ol |
| SMILES | CC(CO)(CCSCCS(C)(=O)=O)NC1CC1 |
| InChI | InChI=1S/C11H23NO3S2/c1-11(9-13,12-10-3-4-10)5-6-16-7-8-17(2,14)15/h10,12-13H,3-9H2,1-2H3 |
| InChIKey | ZRPWCUZLIKAKCQ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|