C12H25NOS — CID 64818836
4-tert-butylsulfanyl-2-(cyclopropylamino)-2-methylbutan-1-ol (PubChem CID 64818836) has the molecular formula C12H25NOS and a molecular weight of 231.40 g/mol. Its IUPAC name is 4-tert-butylsulfanyl-2-(cyclopropylamino)-2-methylbutan-1-ol.
| Compound Name | 4-tert-butylsulfanyl-2-(cyclopropylamino)-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 64818836 |
| Molecular Formula | C12H25NOS |
| Molecular Weight | 231.40 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 4-tert-butylsulfanyl-2-(cyclopropylamino)-2-methylbutan-1-ol |
| SMILES | CC(CO)(CCSC(C)(C)C)NC1CC1 |
| InChI | InChI=1S/C12H25NOS/c1-11(2,3)15-8-7-12(4,9-14)13-10-5-6-10/h10,13-14H,5-9H2,1-4H3 |
| InChIKey | JXNWOAMIPHTCQA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |