C11H20ClN3O — CID 64810937
3-(4-chloro-5-methylpyrazol-1-yl)-2-methyl-2-(propan-2-ylamino)propan-1-ol (PubChem CID 64810937) has the molecular formula C11H20ClN3O and a molecular weight of 245.75 g/mol. Its IUPAC name is 3-(4-chloro-5-methylpyrazol-1-yl)-2-methyl-2-(propan-2-ylamino)propan-1-ol.
| Compound Name | 3-(4-chloro-5-methylpyrazol-1-yl)-2-methyl-2-(propan-2-ylamino)propan-1-ol |
|---|---|
| PubChem CID | 64810937 |
| Molecular Formula | C11H20ClN3O |
| Molecular Weight | 245.75 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 3-(4-chloro-5-methylpyrazol-1-yl)-2-methyl-2-(propan-2-ylamino)propan-1-ol |
| SMILES | Cc1c(Cl)cnn1CC(C)(CO)NC(C)C |
| InChI | InChI=1S/C11H20ClN3O/c1-8(2)14-11(4,7-16)6-15-9(3)10(12)5-13-15/h5,8,14,16H,6-7H2,1-4H3 |
| InChIKey | GQYPCKHPPWOMOK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.75 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |