C12H20ClN3O — CID 64811575
3-(4-chloro-5-methylpyrazol-1-yl)-2-cyclopropyl-2-(ethylamino)propan-1-ol (PubChem CID 64811575) has the molecular formula C12H20ClN3O and a molecular weight of 257.76 g/mol. Its IUPAC name is 3-(4-chloro-5-methylpyrazol-1-yl)-2-cyclopropyl-2-(ethylamino)propan-1-ol.
| Compound Name | 3-(4-chloro-5-methylpyrazol-1-yl)-2-cyclopropyl-2-(ethylamino)propan-1-ol |
|---|---|
| PubChem CID | 64811575 |
| Molecular Formula | C12H20ClN3O |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 3-(4-chloro-5-methylpyrazol-1-yl)-2-cyclopropyl-2-(ethylamino)propan-1-ol |
| SMILES | CCNC(CO)(Cn1ncc(Cl)c1C)C1CC1 |
| InChI | InChI=1S/C12H20ClN3O/c1-3-14-12(8-17,10-4-5-10)7-16-9(2)11(13)6-15-16/h6,10,14,17H,3-5,7-8H2,1-2H3 |
| InChIKey | DZQBVKRNBCAPNL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |