C17H25N3O — CID 64818303
(2-aminocyclohexyl)-(4-phenylpiperazin-1-yl)methanone (PubChem CID 64818303) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is (2-aminocyclohexyl)-(4-phenylpiperazin-1-yl)methanone.
| Compound Name | (2-aminocyclohexyl)-(4-phenylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 64818303 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | (2-aminocyclohexyl)-(4-phenylpiperazin-1-yl)methanone |
| SMILES | NC1CCCCC1C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C17H25N3O/c18-16-9-5-4-8-15(16)17(21)20-12-10-19(11-13-20)14-6-2-1-3-7-14/h1-3,6-7,15-16H,4-5,8-13,18H2 |
| InChIKey | WCCWWXOVNFXILB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |