C16H22FN3O — CID 64823960
(2-aminocyclopentyl)-[4-(2-fluorophenyl)piperazin-1-yl]methanone (PubChem CID 64823960) has the molecular formula C16H22FN3O and a molecular weight of 291.37 g/mol. Its IUPAC name is (2-aminocyclopentyl)-[4-(2-fluorophenyl)piperazin-1-yl]methanone.
| Compound Name | (2-aminocyclopentyl)-[4-(2-fluorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 64823960 |
| Molecular Formula | C16H22FN3O |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | (2-aminocyclopentyl)-[4-(2-fluorophenyl)piperazin-1-yl]methanone |
| SMILES | NC1CCCC1C(=O)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C16H22FN3O/c17-13-5-1-2-7-15(13)19-8-10-20(11-9-19)16(21)12-4-3-6-14(12)18/h1-2,5,7,12,14H,3-4,6,8-11,18H2 |
| InChIKey | DCBSSNIMRUJCSZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |