C15H20FN3O2 — CID 66240445
(4-aminooxolan-3-yl)-[4-(2-fluorophenyl)piperazin-1-yl]methanone (PubChem CID 66240445) has the molecular formula C15H20FN3O2 and a molecular weight of 293.34 g/mol. Its IUPAC name is (4-aminooxolan-3-yl)-[4-(2-fluorophenyl)piperazin-1-yl]methanone.
| Compound Name | (4-aminooxolan-3-yl)-[4-(2-fluorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 66240445 |
| Molecular Formula | C15H20FN3O2 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | (4-aminooxolan-3-yl)-[4-(2-fluorophenyl)piperazin-1-yl]methanone |
| SMILES | NC1COCC1C(=O)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C15H20FN3O2/c16-12-3-1-2-4-14(12)18-5-7-19(8-6-18)15(20)11-9-21-10-13(11)17/h1-4,11,13H,5-10,17H2 |
| InChIKey | MNBBCLNFGXGCCL-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |