About 5-ethylquinolin-8-ol
5-ethylquinolin-8-ol (PubChem CID 6481991) has the molecular formula C11H11NO
and a molecular weight of 173.22 g/mol. Its IUPAC name is 5-ethylquinolin-8-ol.
Molecular Properties
| Compound Name | 5-ethylquinolin-8-ol |
| PubChem CID | 6481991 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 5-ethylquinolin-8-ol |
| SMILES | CCc1ccc(O)c2ncccc12 |
| InChI | InChI=1S/C11H11NO/c1-2-8-5-6-10(13)11-9(8)4-3-7-12-11/h3-7,13H,2H2,1H3 |
| InChIKey | DLLAEYWNEZQGQD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethylquinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylquinolin-8-ol?
The IUPAC name of 5-ethylquinolin-8-ol (CID 6481991) is 5-ethylquinolin-8-ol.
What is the SMILES notation for 5-ethylquinolin-8-ol?
The canonical SMILES for 5-ethylquinolin-8-ol is CCc1ccc(O)c2ncccc12.
What is the InChIKey of 5-ethylquinolin-8-ol?
The InChIKey is DLLAEYWNEZQGQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO/c1-2-8-5-6-10(13)11-9(8)4-3-7-12-11/h3-7,13H,2H2,1H3.
What are the key properties of 5-ethylquinolin-8-ol?
5-ethylquinolin-8-ol has a molecular weight of 173.22 g/mol, XLogP of 2.50, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylquinolin-8-ol is sourced from PubChem (CID 6481991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).