C14H32N4O — CID 64820717
1-amino-4-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-2-methylpentan-2-ol (PubChem CID 64820717) has the molecular formula C14H32N4O and a molecular weight of 272.44 g/mol. Its IUPAC name is 1-amino-4-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-2-methylpentan-2-ol.
| Compound Name | 1-amino-4-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-2-methylpentan-2-ol |
|---|---|
| PubChem CID | 64820717 |
| Molecular Formula | C14H32N4O |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.26 |
| IUPAC Name | 1-amino-4-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-2-methylpentan-2-ol |
| SMILES | CC(CC(C)(O)CN)N1CCN(CCN(C)C)CC1 |
| InChI | InChI=1S/C14H32N4O/c1-13(11-14(2,19)12-15)18-9-7-17(8-10-18)6-5-16(3)4/h13,19H,5-12,15H2,1-4H3 |
| InChIKey | JRZGRCAAQLODPL-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 55.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |