C19H27BrN2O — CID 6482620
4-[6-(4-bromophenoxy)hexyl]-3,5-diethyl-1H-pyrazole (PubChem CID 6482620) has the molecular formula C19H27BrN2O and a molecular weight of 379.34 g/mol. Its IUPAC name is 4-[6-(4-bromophenoxy)hexyl]-3,5-diethyl-1H-pyrazole.
| Compound Name | 4-[6-(4-bromophenoxy)hexyl]-3,5-diethyl-1H-pyrazole |
|---|---|
| PubChem CID | 6482620 |
| Molecular Formula | C19H27BrN2O |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 4-[6-(4-bromophenoxy)hexyl]-3,5-diethyl-1H-pyrazole |
| SMILES | CCc1n[nH]c(CC)c1CCCCCCOc1ccc(Br)cc1 |
| InChI | InChI=1S/C19H27BrN2O/c1-3-18-17(19(4-2)22-21-18)9-7-5-6-8-14-23-16-12-10-15(20)11-13-16/h10-13H,3-9,14H2,1-2H3,(H,21,22) |
| InChIKey | AYFPNVHZOKFQJV-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|