C14H30N2O — CID 64827129
3-[cyclopropyl(2-methylpropyl)amino]-2-methyl-2-(propan-2-ylamino)propan-1-ol (PubChem CID 64827129) has the molecular formula C14H30N2O and a molecular weight of 242.41 g/mol. Its IUPAC name is 3-[cyclopropyl(2-methylpropyl)amino]-2-methyl-2-(propan-2-ylamino)propan-1-ol.
| Compound Name | 3-[cyclopropyl(2-methylpropyl)amino]-2-methyl-2-(propan-2-ylamino)propan-1-ol |
|---|---|
| PubChem CID | 64827129 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | 3-[cyclopropyl(2-methylpropyl)amino]-2-methyl-2-(propan-2-ylamino)propan-1-ol |
| SMILES | CC(C)CN(CC(C)(CO)NC(C)C)C1CC1 |
| InChI | InChI=1S/C14H30N2O/c1-11(2)8-16(13-6-7-13)9-14(5,10-17)15-12(3)4/h11-13,15,17H,6-10H2,1-5H3 |
| InChIKey | HOQLREXZXVBHNH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |