C14H30N2O — CID 64826138
4-[cyclopropyl(2-methylpropyl)amino]-2-(ethylamino)-2-methylbutan-1-ol (PubChem CID 64826138) has the molecular formula C14H30N2O and a molecular weight of 242.41 g/mol. Its IUPAC name is 4-[cyclopropyl(2-methylpropyl)amino]-2-(ethylamino)-2-methylbutan-1-ol.
| Compound Name | 4-[cyclopropyl(2-methylpropyl)amino]-2-(ethylamino)-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 64826138 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | 4-[cyclopropyl(2-methylpropyl)amino]-2-(ethylamino)-2-methylbutan-1-ol |
| SMILES | CCNC(C)(CO)CCN(CC(C)C)C1CC1 |
| InChI | InChI=1S/C14H30N2O/c1-5-15-14(4,11-17)8-9-16(10-12(2)3)13-6-7-13/h12-13,15,17H,5-11H2,1-4H3 |
| InChIKey | BKXRGXLTUOYVTG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |