C13H30N2O — CID 64789633
2-(ethylamino)-2-methyl-4-[methyl(2-methylbutan-2-yl)amino]butan-1-ol (PubChem CID 64789633) has the molecular formula C13H30N2O and a molecular weight of 230.40 g/mol. Its IUPAC name is 2-(ethylamino)-2-methyl-4-[methyl(2-methylbutan-2-yl)amino]butan-1-ol.
| Compound Name | 2-(ethylamino)-2-methyl-4-[methyl(2-methylbutan-2-yl)amino]butan-1-ol |
|---|---|
| PubChem CID | 64789633 |
| Molecular Formula | C13H30N2O |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.24 |
| IUPAC Name | 2-(ethylamino)-2-methyl-4-[methyl(2-methylbutan-2-yl)amino]butan-1-ol |
| SMILES | CCNC(C)(CO)CCN(C)C(C)(C)CC |
| InChI | InChI=1S/C13H30N2O/c1-7-12(3,4)15(6)10-9-13(5,11-16)14-8-2/h14,16H,7-11H2,1-6H3 |
| InChIKey | FYKUAAKIEIBVKP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |